C18H26N2O3S — CID 50740238
2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N,N-diethyl-4-methylsulfanylbutanamide (PubChem CID 50740238) has the molecular formula C18H26N2O3S and a molecular weight of 350.48 g/mol. Its IUPAC name is 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N,N-diethyl-4-methylsulfanylbutanamide.
| Compound Name | 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N,N-diethyl-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 50740238 |
| Molecular Formula | C18H26N2O3S |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N,N-diethyl-4-methylsulfanylbutanamide |
| SMILES | CCN(CC)C(=O)C(CCSC)N1C(=O)C2C3C=CC(C3)C2C1=O |
| InChI | InChI=1S/C18H26N2O3S/c1-4-19(5-2)16(21)13(8-9-24-3)20-17(22)14-11-6-7-12(10-11)15(14)18(20)23/h6-7,11-15H,4-5,8-10H2,1-3H3 |
| InChIKey | AMRREFJTGUUAMK-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|