C17H19N3O3S2 — CID 50740185
2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-4-methylsulfanyl-N-(1,3-thiazol-2-yl)butanamide (PubChem CID 50740185) has the molecular formula C17H19N3O3S2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-4-methylsulfanyl-N-(1,3-thiazol-2-yl)butanamide.
| Compound Name | 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-4-methylsulfanyl-N-(1,3-thiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 50740185 |
| Molecular Formula | C17H19N3O3S2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-4-methylsulfanyl-N-(1,3-thiazol-2-yl)butanamide |
| SMILES | CSCCC(C(=O)Nc1nccs1)N1C(=O)C2C3C=CC(C3)C2C1=O |
| InChI | InChI=1S/C17H19N3O3S2/c1-24-6-4-11(14(21)19-17-18-5-7-25-17)20-15(22)12-9-2-3-10(8-9)13(12)16(20)23/h2-3,5,7,9-13H,4,6,8H2,1H3,(H,18,19,21) |
| InChIKey | HIRYOQUDSVCFJU-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|