C30H28N2O4S — CID 27761795
(2R)-2-[(15S,19R)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]-N-(2-methoxyphenyl)-4-methylsulfanylbutanamide (PubChem CID 27761795) has the molecular formula C30H28N2O4S and a molecular weight of 512.63 g/mol. Its IUPAC name is (2R)-2-[(15S,19R)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]-N-(2-methoxyphenyl)-4-methylsulfanylbutanamide.
| Compound Name | (2R)-2-[(15S,19R)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]-N-(2-methoxyphenyl)-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 27761795 |
| Molecular Formula | C30H28N2O4S |
| Molecular Weight | 512.63 g/mol |
| Exact Mass | 512.18 |
| IUPAC Name | (2R)-2-[(15S,19R)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]-N-(2-methoxyphenyl)-4-methylsulfanylbutanamide |
| SMILES | COc1ccccc1NC(=O)[C@@H](CCSC)N1C(=O)[C@@H]2C3c4ccccc4C(c4ccccc43)[C@@H]2C1=O |
| InChI | InChI=1S/C30H28N2O4S/c1-36-23-14-8-7-13-21(23)31-28(33)22(15-16-37-2)32-29(34)26-24-17-9-3-4-10-18(17)25(27(26)30(32)35)20-12-6-5-11-19(20)24/h3-14,22,24-27H,15-16H2,1-2H3,(H,31,33)/t22-,24?,25?,26-,27+/m1/s1 |
| InChIKey | QDBRCJQGWLXIDH-PXGXXNHBSA-N |
| XLogP | 4.65 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.63 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|