C23H25FN2O4S — CID 40971492
(3S,7aS)-6-butyl-3-[3-[(2-fluorophenoxy)methyl]-4-methoxyphenyl]-3,7a-dihydro-1H-imidazo[1,5-c][1,3]thiazole-5,7-dione (PubChem CID 40971492) has the molecular formula C23H25FN2O4S and a molecular weight of 444.53 g/mol. Its IUPAC name is (3S,7aS)-6-butyl-3-[3-[(2-fluorophenoxy)methyl]-4-methoxyphenyl]-3,7a-dihydro-1H-imidazo[1,5-c][1,3]thiazole-5,7-dione.
| Compound Name | (3S,7aS)-6-butyl-3-[3-[(2-fluorophenoxy)methyl]-4-methoxyphenyl]-3,7a-dihydro-1H-imidazo[1,5-c][1,3]thiazole-5,7-dione |
|---|---|
| PubChem CID | 40971492 |
| Molecular Formula | C23H25FN2O4S |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | (3S,7aS)-6-butyl-3-[3-[(2-fluorophenoxy)methyl]-4-methoxyphenyl]-3,7a-dihydro-1H-imidazo[1,5-c][1,3]thiazole-5,7-dione |
| SMILES | CCCCN1C(=O)[C@H]2CS[C@@H](c3ccc(OC)c(COc4ccccc4F)c3)N2C1=O |
| InChI | InChI=1S/C23H25FN2O4S/c1-3-4-11-25-21(27)18-14-31-22(26(18)23(25)28)15-9-10-19(29-2)16(12-15)13-30-20-8-6-5-7-17(20)24/h5-10,12,18,22H,3-4,11,13-14H2,1-2H3/t18-,22+/m1/s1 |
| InChIKey | NOWUBPCUQAMEMO-GCJKJVERSA-N |
| XLogP | 4.59 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|