C25H31FN4O3S — CID 3601356
2-[[5-[(2-fluorophenoxy)methyl]-4-hexyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(2-methoxyphenyl)methyl]acetamide (PubChem CID 3601356) has the molecular formula C25H31FN4O3S and a molecular weight of 486.61 g/mol. Its IUPAC name is 2-[[5-[(2-fluorophenoxy)methyl]-4-hexyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(2-methoxyphenyl)methyl]acetamide.
| Compound Name | 2-[[5-[(2-fluorophenoxy)methyl]-4-hexyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(2-methoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 3601356 |
| Molecular Formula | C25H31FN4O3S |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | 2-[[5-[(2-fluorophenoxy)methyl]-4-hexyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(2-methoxyphenyl)methyl]acetamide |
| SMILES | CCCCCCn1c(COc2ccccc2F)nnc1SCC(=O)NCc1ccccc1OC |
| InChI | InChI=1S/C25H31FN4O3S/c1-3-4-5-10-15-30-23(17-33-22-14-9-7-12-20(22)26)28-29-25(30)34-18-24(31)27-16-19-11-6-8-13-21(19)32-2/h6-9,11-14H,3-5,10,15-18H2,1-2H3,(H,27,31) |
| InChIKey | RUWJNTKJYBGCKR-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|