C27H35FN4O2S — CID 4537653
N-(4-butan-2-ylphenyl)-2-[[5-[(2-fluorophenoxy)methyl]-4-hexyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 4537653) has the molecular formula C27H35FN4O2S and a molecular weight of 498.67 g/mol. Its IUPAC name is N-(4-butan-2-ylphenyl)-2-[[5-[(2-fluorophenoxy)methyl]-4-hexyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(4-butan-2-ylphenyl)-2-[[5-[(2-fluorophenoxy)methyl]-4-hexyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 4537653 |
| Molecular Formula | C27H35FN4O2S |
| Molecular Weight | 498.67 g/mol |
| Exact Mass | 498.25 |
| IUPAC Name | N-(4-butan-2-ylphenyl)-2-[[5-[(2-fluorophenoxy)methyl]-4-hexyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CCCCCCn1c(COc2ccccc2F)nnc1SCC(=O)Nc1ccc(C(C)CC)cc1 |
| InChI | InChI=1S/C27H35FN4O2S/c1-4-6-7-10-17-32-25(18-34-24-12-9-8-11-23(24)28)30-31-27(32)35-19-26(33)29-22-15-13-21(14-16-22)20(3)5-2/h8-9,11-16,20H,4-7,10,17-19H2,1-3H3,(H,29,33) |
| InChIKey | UTXAEQVNMCLBRF-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.67 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|