C26H30FN5O2S — CID 3885258
N-(2-cyanoethyl)-2-[[5-[(2-fluorophenoxy)methyl]-4-hexyl-1,2,4-triazol-3-yl]sulfanyl]-N-phenylacetamide (PubChem CID 3885258) has the molecular formula C26H30FN5O2S and a molecular weight of 495.62 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-[[5-[(2-fluorophenoxy)methyl]-4-hexyl-1,2,4-triazol-3-yl]sulfanyl]-N-phenylacetamide.
| Compound Name | N-(2-cyanoethyl)-2-[[5-[(2-fluorophenoxy)methyl]-4-hexyl-1,2,4-triazol-3-yl]sulfanyl]-N-phenylacetamide |
|---|---|
| PubChem CID | 3885258 |
| Molecular Formula | C26H30FN5O2S |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | N-(2-cyanoethyl)-2-[[5-[(2-fluorophenoxy)methyl]-4-hexyl-1,2,4-triazol-3-yl]sulfanyl]-N-phenylacetamide |
| SMILES | CCCCCCn1c(COc2ccccc2F)nnc1SCC(=O)N(CCC#N)c1ccccc1 |
| InChI | InChI=1S/C26H30FN5O2S/c1-2-3-4-10-17-32-24(19-34-23-15-9-8-14-22(23)27)29-30-26(32)35-20-25(33)31(18-11-16-28)21-12-6-5-7-13-21/h5-9,12-15H,2-4,10-11,17-20H2,1H3 |
| InChIKey | KXLLHXAFITUTRQ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 84.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|