C17H20N4OS3 — CID 55375669
2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(2-cyanoethyl)-N-phenylacetamide (PubChem CID 55375669) has the molecular formula C17H20N4OS3 and a molecular weight of 392.58 g/mol. Its IUPAC name is 2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(2-cyanoethyl)-N-phenylacetamide.
| Compound Name | 2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(2-cyanoethyl)-N-phenylacetamide |
|---|---|
| PubChem CID | 55375669 |
| Molecular Formula | C17H20N4OS3 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(2-cyanoethyl)-N-phenylacetamide |
| SMILES | CCCCSc1nnc(SCC(=O)N(CCC#N)c2ccccc2)s1 |
| InChI | InChI=1S/C17H20N4OS3/c1-2-3-12-23-16-19-20-17(25-16)24-13-15(22)21(11-7-10-18)14-8-5-4-6-9-14/h4-6,8-9H,2-3,7,11-13H2,1H3 |
| InChIKey | NXEJFQYYJJFMFE-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 69.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|