C18H24N4O2S3 — CID 24571885
3-[benzyl-[2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]amino]propanamide (PubChem CID 24571885) has the molecular formula C18H24N4O2S3 and a molecular weight of 424.62 g/mol. Its IUPAC name is 3-[benzyl-[2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]amino]propanamide.
| Compound Name | 3-[benzyl-[2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]amino]propanamide |
|---|---|
| PubChem CID | 24571885 |
| Molecular Formula | C18H24N4O2S3 |
| Molecular Weight | 424.62 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 3-[benzyl-[2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]amino]propanamide |
| SMILES | CCCCSc1nnc(SCC(=O)N(CCC(N)=O)Cc2ccccc2)s1 |
| InChI | InChI=1S/C18H24N4O2S3/c1-2-3-11-25-17-20-21-18(27-17)26-13-16(24)22(10-9-15(19)23)12-14-7-5-4-6-8-14/h4-8H,2-3,9-13H2,1H3,(H2,19,23) |
| InChIKey | USHTVVAOQMTCDH-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.62 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|