C18H23N3OS3 — CID 55845116
N-benzyl-2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-cyclopropylacetamide (PubChem CID 55845116) has the molecular formula C18H23N3OS3 and a molecular weight of 393.60 g/mol. Its IUPAC name is N-benzyl-2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-cyclopropylacetamide.
| Compound Name | N-benzyl-2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-cyclopropylacetamide |
|---|---|
| PubChem CID | 55845116 |
| Molecular Formula | C18H23N3OS3 |
| Molecular Weight | 393.60 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | N-benzyl-2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-cyclopropylacetamide |
| SMILES | CCCCSc1nnc(SCC(=O)N(Cc2ccccc2)C2CC2)s1 |
| InChI | InChI=1S/C18H23N3OS3/c1-2-3-11-23-17-19-20-18(25-17)24-13-16(22)21(15-9-10-15)12-14-7-5-4-6-8-14/h4-8,15H,2-3,9-13H2,1H3 |
| InChIKey | AYMVUIPJFJMSMN-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.60 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|