C21H21N3O2S — CID 55848685
N-benzyl-N-cyclopropyl-2-(3-methyl-4-oxoquinazolin-2-yl)sulfanylacetamide (PubChem CID 55848685) has the molecular formula C21H21N3O2S and a molecular weight of 379.49 g/mol. Its IUPAC name is N-benzyl-N-cyclopropyl-2-(3-methyl-4-oxoquinazolin-2-yl)sulfanylacetamide.
| Compound Name | N-benzyl-N-cyclopropyl-2-(3-methyl-4-oxoquinazolin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 55848685 |
| Molecular Formula | C21H21N3O2S |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | N-benzyl-N-cyclopropyl-2-(3-methyl-4-oxoquinazolin-2-yl)sulfanylacetamide |
| SMILES | Cn1c(SCC(=O)N(Cc2ccccc2)C2CC2)nc2ccccc2c1=O |
| InChI | InChI=1S/C21H21N3O2S/c1-23-20(26)17-9-5-6-10-18(17)22-21(23)27-14-19(25)24(16-11-12-16)13-15-7-3-2-4-8-15/h2-10,16H,11-14H2,1H3 |
| InChIKey | QCYOLUNSQUSKIE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |