C18H19ClN2O2 — CID 40977183
N'-(3-chloro-2-methylphenyl)-N-[(2R)-2-phenylpropyl]oxamide (PubChem CID 40977183) has the molecular formula C18H19ClN2O2 and a molecular weight of 330.82 g/mol. Its IUPAC name is N'-(3-chloro-2-methylphenyl)-N-[(2R)-2-phenylpropyl]oxamide.
| Compound Name | N'-(3-chloro-2-methylphenyl)-N-[(2R)-2-phenylpropyl]oxamide |
|---|---|
| PubChem CID | 40977183 |
| Molecular Formula | C18H19ClN2O2 |
| Molecular Weight | 330.82 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | N'-(3-chloro-2-methylphenyl)-N-[(2R)-2-phenylpropyl]oxamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)C(=O)NC[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C18H19ClN2O2/c1-12(14-7-4-3-5-8-14)11-20-17(22)18(23)21-16-10-6-9-15(19)13(16)2/h3-10,12H,11H2,1-2H3,(H,20,22)(H,21,23)/t12-/m0/s1 |
| InChIKey | ARLIZWZUVAYTRT-LBPRGKRZSA-N |
| XLogP | 3.51 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.82 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|