C17H20ClN3O2S — CID 16932117
N'-(3-chloro-2-methylphenyl)-N-[2-(dimethylamino)-2-thiophen-3-ylethyl]oxamide (PubChem CID 16932117) has the molecular formula C17H20ClN3O2S and a molecular weight of 365.89 g/mol. Its IUPAC name is N'-(3-chloro-2-methylphenyl)-N-[2-(dimethylamino)-2-thiophen-3-ylethyl]oxamide.
| Compound Name | N'-(3-chloro-2-methylphenyl)-N-[2-(dimethylamino)-2-thiophen-3-ylethyl]oxamide |
|---|---|
| PubChem CID | 16932117 |
| Molecular Formula | C17H20ClN3O2S |
| Molecular Weight | 365.89 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | N'-(3-chloro-2-methylphenyl)-N-[2-(dimethylamino)-2-thiophen-3-ylethyl]oxamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)C(=O)NCC(c1ccsc1)N(C)C |
| InChI | InChI=1S/C17H20ClN3O2S/c1-11-13(18)5-4-6-14(11)20-17(23)16(22)19-9-15(21(2)3)12-7-8-24-10-12/h4-8,10,15H,9H2,1-3H3,(H,19,22)(H,20,23) |
| InChIKey | KKUOQKNJPNHWRI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.89 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|