C30H36N4O4S — CID 4097765
N-[bis[4-(dimethylamino)phenyl]methylidene]-3-(2,6-dimethylmorpholin-4-yl)sulfonylbenzamide (PubChem CID 4097765) has the molecular formula C30H36N4O4S and a molecular weight of 548.71 g/mol. Its IUPAC name is N-[bis[4-(dimethylamino)phenyl]methylidene]-3-(2,6-dimethylmorpholin-4-yl)sulfonylbenzamide.
| Compound Name | N-[bis[4-(dimethylamino)phenyl]methylidene]-3-(2,6-dimethylmorpholin-4-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 4097765 |
| Molecular Formula | C30H36N4O4S |
| Molecular Weight | 548.71 g/mol |
| Exact Mass | 548.25 |
| IUPAC Name | N-[bis[4-(dimethylamino)phenyl]methylidene]-3-(2,6-dimethylmorpholin-4-yl)sulfonylbenzamide |
| SMILES | CC1CN(S(=O)(=O)c2cccc(C(=O)N=C(c3ccc(N(C)C)cc3)c3ccc(N(C)C)cc3)c2)CC(C)O1 |
| InChI | InChI=1S/C30H36N4O4S/c1-21-19-34(20-22(2)38-21)39(36,37)28-9-7-8-25(18-28)30(35)31-29(23-10-14-26(15-11-23)32(3)4)24-12-16-27(17-13-24)33(5)6/h7-18,21-22H,19-20H2,1-6H3 |
| InChIKey | IWRXORYKFRPGBO-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 82.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.71 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|