C25H24N4O5 — CID 40983770
(3S,3'aR,8'aR,8'bS)-6,7-dimethyl-2'-(2-methyl-3-nitrophenyl)spiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-1',2,3'-trione (PubChem CID 40983770) has the molecular formula C25H24N4O5 and a molecular weight of 460.49 g/mol. Its IUPAC name is (3S,3'aR,8'aR,8'bS)-6,7-dimethyl-2'-(2-methyl-3-nitrophenyl)spiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-1',2,3'-trione.
| Compound Name | (3S,3'aR,8'aR,8'bS)-6,7-dimethyl-2'-(2-methyl-3-nitrophenyl)spiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-1',2,3'-trione |
|---|---|
| PubChem CID | 40983770 |
| Molecular Formula | C25H24N4O5 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | (3S,3'aR,8'aR,8'bS)-6,7-dimethyl-2'-(2-methyl-3-nitrophenyl)spiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-1',2,3'-trione |
| SMILES | Cc1ccc2c(c1C)NC(=O)[C@]21[C@@H]2C(=O)N(c3cccc([N+](=O)[O-])c3C)C(=O)[C@@H]2[C@H]2CCCN21 |
| InChI | InChI=1S/C25H24N4O5/c1-12-9-10-15-21(13(12)2)26-24(32)25(15)20-19(18-8-5-11-27(18)25)22(30)28(23(20)31)16-6-4-7-17(14(16)3)29(33)34/h4,6-7,9-10,18-20H,5,8,11H2,1-3H3,(H,26,32)/t18-,19-,20+,25-/m1/s1 |
| InChIKey | SAEDGDGIBNELAE-MVOHMCPASA-N |
| XLogP | 2.95 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|