C25H30N4O4 — CID 40989815
ethyl (3S,4S)-4-[4-(dimethylamino)phenyl]-1-(3-methoxypropyl)-2-oxo-3,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate (PubChem CID 40989815) has the molecular formula C25H30N4O4 and a molecular weight of 450.54 g/mol. Its IUPAC name is ethyl (3S,4S)-4-[4-(dimethylamino)phenyl]-1-(3-methoxypropyl)-2-oxo-3,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate.
| Compound Name | ethyl (3S,4S)-4-[4-(dimethylamino)phenyl]-1-(3-methoxypropyl)-2-oxo-3,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate |
|---|---|
| PubChem CID | 40989815 |
| Molecular Formula | C25H30N4O4 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | ethyl (3S,4S)-4-[4-(dimethylamino)phenyl]-1-(3-methoxypropyl)-2-oxo-3,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C(=O)N(CCCOC)c2nc3ccccc3n2[C@@H]1c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C25H30N4O4/c1-5-33-24(31)21-22(17-11-13-18(14-12-17)27(2)3)29-20-10-7-6-9-19(20)26-25(29)28(23(21)30)15-8-16-32-4/h6-7,9-14,21-22H,5,8,15-16H2,1-4H3/t21-,22+/m0/s1 |
| InChIKey | IRSLNKGLUALEAZ-FCHUYYIVSA-N |
| XLogP | 3.25 |
| TPSA | 76.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|