C25H19N3O3S — CID 40995809
N-(4,5-dimethyl-1,3-benzothiazol-2-yl)-2-oxo-N-(pyridin-3-ylmethyl)chromene-3-carboxamide (PubChem CID 40995809) has the molecular formula C25H19N3O3S and a molecular weight of 441.51 g/mol. Its IUPAC name is N-(4,5-dimethyl-1,3-benzothiazol-2-yl)-2-oxo-N-(pyridin-3-ylmethyl)chromene-3-carboxamide.
| Compound Name | N-(4,5-dimethyl-1,3-benzothiazol-2-yl)-2-oxo-N-(pyridin-3-ylmethyl)chromene-3-carboxamide |
|---|---|
| PubChem CID | 40995809 |
| Molecular Formula | C25H19N3O3S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | N-(4,5-dimethyl-1,3-benzothiazol-2-yl)-2-oxo-N-(pyridin-3-ylmethyl)chromene-3-carboxamide |
| SMILES | Cc1ccc2sc(N(Cc3cccnc3)C(=O)c3cc4ccccc4oc3=O)nc2c1C |
| InChI | InChI=1S/C25H19N3O3S/c1-15-9-10-21-22(16(15)2)27-25(32-21)28(14-17-6-5-11-26-13-17)23(29)19-12-18-7-3-4-8-20(18)31-24(19)30/h3-13H,14H2,1-2H3 |
| InChIKey | XLLSWVABMSGISK-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|