C24H14F3N3O3S — CID 121037842
2-oxo-N-(pyridin-3-ylmethyl)-N-[4-(trifluoromethyl)-1,3-benzothiazol-2-yl]chromene-3-carboxamide (PubChem CID 121037842) has the molecular formula C24H14F3N3O3S and a molecular weight of 481.46 g/mol. Its IUPAC name is 2-oxo-N-(pyridin-3-ylmethyl)-N-[4-(trifluoromethyl)-1,3-benzothiazol-2-yl]chromene-3-carboxamide.
| Compound Name | 2-oxo-N-(pyridin-3-ylmethyl)-N-[4-(trifluoromethyl)-1,3-benzothiazol-2-yl]chromene-3-carboxamide |
|---|---|
| PubChem CID | 121037842 |
| Molecular Formula | C24H14F3N3O3S |
| Molecular Weight | 481.46 g/mol |
| Exact Mass | 481.07 |
| IUPAC Name | 2-oxo-N-(pyridin-3-ylmethyl)-N-[4-(trifluoromethyl)-1,3-benzothiazol-2-yl]chromene-3-carboxamide |
| SMILES | O=C(c1cc2ccccc2oc1=O)N(Cc1cccnc1)c1nc2c(C(F)(F)F)cccc2s1 |
| InChI | InChI=1S/C24H14F3N3O3S/c25-24(26,27)17-7-3-9-19-20(17)29-23(34-19)30(13-14-5-4-10-28-12-14)21(31)16-11-15-6-1-2-8-18(15)33-22(16)32/h1-12H,13H2 |
| InChIKey | LOVOODMDXHCENJ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.46 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|