C19H14IN3O2S2 — CID 40998612
4-iodo-N-[2-methyl-5-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]benzenesulfonamide (PubChem CID 40998612) has the molecular formula C19H14IN3O2S2 and a molecular weight of 507.38 g/mol. Its IUPAC name is 4-iodo-N-[2-methyl-5-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]benzenesulfonamide.
| Compound Name | 4-iodo-N-[2-methyl-5-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 40998612 |
| Molecular Formula | C19H14IN3O2S2 |
| Molecular Weight | 507.38 g/mol |
| Exact Mass | 506.96 |
| IUPAC Name | 4-iodo-N-[2-methyl-5-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]benzenesulfonamide |
| SMILES | Cc1ccc(-c2nc3cccnc3s2)cc1NS(=O)(=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C19H14IN3O2S2/c1-12-4-5-13(18-22-16-3-2-10-21-19(16)26-18)11-17(12)23-27(24,25)15-8-6-14(20)7-9-15/h2-11,23H,1H3 |
| InChIKey | VGHNDTQMNUGPGC-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.38 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|