C26H24N4O7 — CID 41000445
ethyl 4-[hydroxy-[(2R)-2-(4-nitrophenyl)-4,5-dioxo-1-(pyridin-3-ylmethyl)pyrrolidin-3-ylidene]methyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate (PubChem CID 41000445) has the molecular formula C26H24N4O7 and a molecular weight of 504.50 g/mol. Its IUPAC name is ethyl 4-[hydroxy-[(2R)-2-(4-nitrophenyl)-4,5-dioxo-1-(pyridin-3-ylmethyl)pyrrolidin-3-ylidene]methyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 4-[hydroxy-[(2R)-2-(4-nitrophenyl)-4,5-dioxo-1-(pyridin-3-ylmethyl)pyrrolidin-3-ylidene]methyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 41000445 |
| Molecular Formula | C26H24N4O7 |
| Molecular Weight | 504.50 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | ethyl 4-[hydroxy-[(2R)-2-(4-nitrophenyl)-4,5-dioxo-1-(pyridin-3-ylmethyl)pyrrolidin-3-ylidene]methyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c(C)c(C(O)=C2C(=O)C(=O)N(Cc3cccnc3)[C@@H]2c2ccc([N+](=O)[O-])cc2)c1C |
| InChI | InChI=1S/C26H24N4O7/c1-4-37-26(34)21-14(2)19(15(3)28-21)23(31)20-22(17-7-9-18(10-8-17)30(35)36)29(25(33)24(20)32)13-16-6-5-11-27-12-16/h5-12,22,28,31H,4,13H2,1-3H3/t22-/m1/s1 |
| InChIKey | MJRITGQMTZSHBC-JOCHJYFZSA-N |
| XLogP | 3.73 |
| TPSA | 155.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.50 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|