C28H29N3O6 — CID 3435402
ethyl 4-[[2-(4-ethoxyphenyl)-4,5-dioxo-1-(pyridin-3-ylmethyl)pyrrolidin-3-ylidene]-hydroxymethyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate (PubChem CID 3435402) has the molecular formula C28H29N3O6 and a molecular weight of 503.56 g/mol. Its IUPAC name is ethyl 4-[[2-(4-ethoxyphenyl)-4,5-dioxo-1-(pyridin-3-ylmethyl)pyrrolidin-3-ylidene]-hydroxymethyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 4-[[2-(4-ethoxyphenyl)-4,5-dioxo-1-(pyridin-3-ylmethyl)pyrrolidin-3-ylidene]-hydroxymethyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 3435402 |
| Molecular Formula | C28H29N3O6 |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | ethyl 4-[[2-(4-ethoxyphenyl)-4,5-dioxo-1-(pyridin-3-ylmethyl)pyrrolidin-3-ylidene]-hydroxymethyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c(C)c(C(O)=C2C(=O)C(=O)N(Cc3cccnc3)C2c2ccc(OCC)cc2)c1C |
| InChI | InChI=1S/C28H29N3O6/c1-5-36-20-11-9-19(10-12-20)24-22(26(33)27(34)31(24)15-18-8-7-13-29-14-18)25(32)21-16(3)23(30-17(21)4)28(35)37-6-2/h7-14,24,30,32H,5-6,15H2,1-4H3 |
| InChIKey | BHXFFKFFZYTHNU-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 121.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|