C23H23NO3S2 — CID 41000595
N-benzyl-2-(1,3-dithiolan-2-ylidene)-3-[(1R,2S)-2-(4-methoxyphenyl)cyclopropyl]-3-oxopropanamide (PubChem CID 41000595) has the molecular formula C23H23NO3S2 and a molecular weight of 425.58 g/mol. Its IUPAC name is N-benzyl-2-(1,3-dithiolan-2-ylidene)-3-[(1R,2S)-2-(4-methoxyphenyl)cyclopropyl]-3-oxopropanamide.
| Compound Name | N-benzyl-2-(1,3-dithiolan-2-ylidene)-3-[(1R,2S)-2-(4-methoxyphenyl)cyclopropyl]-3-oxopropanamide |
|---|---|
| PubChem CID | 41000595 |
| Molecular Formula | C23H23NO3S2 |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | N-benzyl-2-(1,3-dithiolan-2-ylidene)-3-[(1R,2S)-2-(4-methoxyphenyl)cyclopropyl]-3-oxopropanamide |
| SMILES | COc1ccc([C@H]2C[C@H]2C(=O)C(C(=O)NCc2ccccc2)=C2SCCS2)cc1 |
| InChI | InChI=1S/C23H23NO3S2/c1-27-17-9-7-16(8-10-17)18-13-19(18)21(25)20(23-28-11-12-29-23)22(26)24-14-15-5-3-2-4-6-15/h2-10,18-19H,11-14H2,1H3,(H,24,26)/t18-,19-/m1/s1 |
| InChIKey | MQFYKRKOMCUPSW-RTBURBONSA-N |
| XLogP | 4.38 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|