C15H17NO3S2 — CID 19901141
propan-2-yl 3-(benzylamino)-2-(1,3-dithietan-2-ylidene)-3-oxopropanoate (PubChem CID 19901141) has the molecular formula C15H17NO3S2 and a molecular weight of 323.44 g/mol. Its IUPAC name is propan-2-yl 3-(benzylamino)-2-(1,3-dithietan-2-ylidene)-3-oxopropanoate.
| Compound Name | propan-2-yl 3-(benzylamino)-2-(1,3-dithietan-2-ylidene)-3-oxopropanoate |
|---|---|
| PubChem CID | 19901141 |
| Molecular Formula | C15H17NO3S2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | propan-2-yl 3-(benzylamino)-2-(1,3-dithietan-2-ylidene)-3-oxopropanoate |
| SMILES | CC(C)OC(=O)C(C(=O)NCc1ccccc1)=C1SCS1 |
| InChI | InChI=1S/C15H17NO3S2/c1-10(2)19-14(18)12(15-20-9-21-15)13(17)16-8-11-6-4-3-5-7-11/h3-7,10H,8-9H2,1-2H3,(H,16,17) |
| InChIKey | BLHZRYIYQRSUAN-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|