C27H26N2O5S — CID 41004246
(5S)-5-(3-butoxyphenyl)-4-[hydroxy-[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione (PubChem CID 41004246) has the molecular formula C27H26N2O5S and a molecular weight of 490.58 g/mol. Its IUPAC name is (5S)-5-(3-butoxyphenyl)-4-[hydroxy-[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione.
| Compound Name | (5S)-5-(3-butoxyphenyl)-4-[hydroxy-[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 41004246 |
| Molecular Formula | C27H26N2O5S |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | (5S)-5-(3-butoxyphenyl)-4-[hydroxy-[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione |
| SMILES | CCCCOc1cccc([C@H]2C(=C(O)c3ccc4c(c3)C[C@@H](C)O4)C(=O)C(=O)N2c2nccs2)c1 |
| InChI | InChI=1S/C27H26N2O5S/c1-3-4-11-33-20-7-5-6-17(15-20)23-22(25(31)26(32)29(23)27-28-10-12-35-27)24(30)18-8-9-21-19(14-18)13-16(2)34-21/h5-10,12,14-16,23,30H,3-4,11,13H2,1-2H3/t16-,23+/m1/s1 |
| InChIKey | UTLLKIJOEKLOEC-MWTRTKDXSA-N |
| XLogP | 5.27 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|