C28H29N3O5S — CID 73262248
4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-1-(5-methyl-1,3,4-thiadiazol-2-yl)-5-(3-pentoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 73262248) has the molecular formula C28H29N3O5S and a molecular weight of 519.62 g/mol. Its IUPAC name is 4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-1-(5-methyl-1,3,4-thiadiazol-2-yl)-5-(3-pentoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | 4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-1-(5-methyl-1,3,4-thiadiazol-2-yl)-5-(3-pentoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 73262248 |
| Molecular Formula | C28H29N3O5S |
| Molecular Weight | 519.62 g/mol |
| Exact Mass | 519.18 |
| IUPAC Name | 4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-1-(5-methyl-1,3,4-thiadiazol-2-yl)-5-(3-pentoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | CCCCCOc1cccc(C2C(=C(O)c3ccc4c(c3)CC(C)O4)C(=O)C(=O)N2c2nnc(C)s2)c1 |
| InChI | InChI=1S/C28H29N3O5S/c1-4-5-6-12-35-21-9-7-8-18(15-21)24-23(26(33)27(34)31(24)28-30-29-17(3)37-28)25(32)19-10-11-22-20(14-19)13-16(2)36-22/h7-11,14-16,24,32H,4-6,12-13H2,1-3H3 |
| InChIKey | SKXVUHXVPUWVGG-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 101.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.62 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|