C22H25N3O5 — CID 41009071
N-[(3,4-dimethoxyphenyl)methyl]-N'-[(3R)-2-oxo-1-propan-2-yl-3H-indol-3-yl]oxamide (PubChem CID 41009071) has the molecular formula C22H25N3O5 and a molecular weight of 411.46 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-N'-[(3R)-2-oxo-1-propan-2-yl-3H-indol-3-yl]oxamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-N'-[(3R)-2-oxo-1-propan-2-yl-3H-indol-3-yl]oxamide |
|---|---|
| PubChem CID | 41009071 |
| Molecular Formula | C22H25N3O5 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-N'-[(3R)-2-oxo-1-propan-2-yl-3H-indol-3-yl]oxamide |
| SMILES | COc1ccc(CNC(=O)C(=O)N[C@H]2C(=O)N(C(C)C)c3ccccc32)cc1OC |
| InChI | InChI=1S/C22H25N3O5/c1-13(2)25-16-8-6-5-7-15(16)19(22(25)28)24-21(27)20(26)23-12-14-9-10-17(29-3)18(11-14)30-4/h5-11,13,19H,12H2,1-4H3,(H,23,26)(H,24,27)/t19-/m1/s1 |
| InChIKey | JCXSVKGUERPWLV-LJQANCHMSA-N |
| XLogP | 1.93 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|