C21H24N4O5S — CID 41013752
[2-oxo-2-(prop-2-enylamino)ethyl] 4-[[2-[(5S)-4-oxo-2-pyrrolidin-1-yl-1,3-thiazol-5-yl]acetyl]amino]benzoate (PubChem CID 41013752) has the molecular formula C21H24N4O5S and a molecular weight of 444.51 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-enylamino)ethyl] 4-[[2-[(5S)-4-oxo-2-pyrrolidin-1-yl-1,3-thiazol-5-yl]acetyl]amino]benzoate.
| Compound Name | [2-oxo-2-(prop-2-enylamino)ethyl] 4-[[2-[(5S)-4-oxo-2-pyrrolidin-1-yl-1,3-thiazol-5-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 41013752 |
| Molecular Formula | C21H24N4O5S |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | [2-oxo-2-(prop-2-enylamino)ethyl] 4-[[2-[(5S)-4-oxo-2-pyrrolidin-1-yl-1,3-thiazol-5-yl]acetyl]amino]benzoate |
| SMILES | C=CCNC(=O)COC(=O)c1ccc(NC(=O)C[C@@H]2SC(N3CCCC3)=NC2=O)cc1 |
| InChI | InChI=1S/C21H24N4O5S/c1-2-9-22-18(27)13-30-20(29)14-5-7-15(8-6-14)23-17(26)12-16-19(28)24-21(31-16)25-10-3-4-11-25/h2,5-8,16H,1,3-4,9-13H2,(H,22,27)(H,23,26)/t16-/m0/s1 |
| InChIKey | AEPJZBDCLYIMJU-INIZCTEOSA-N |
| XLogP | 1.57 |
| TPSA | 117.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|