C20H24N4O3S — CID 46531753
3-[[2-(4-oxo-2-piperidin-1-yl-1,3-thiazol-5-yl)acetyl]amino]-N-prop-2-enylbenzamide (PubChem CID 46531753) has the molecular formula C20H24N4O3S and a molecular weight of 400.50 g/mol. Its IUPAC name is 3-[[2-(4-oxo-2-piperidin-1-yl-1,3-thiazol-5-yl)acetyl]amino]-N-prop-2-enylbenzamide.
| Compound Name | 3-[[2-(4-oxo-2-piperidin-1-yl-1,3-thiazol-5-yl)acetyl]amino]-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 46531753 |
| Molecular Formula | C20H24N4O3S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 3-[[2-(4-oxo-2-piperidin-1-yl-1,3-thiazol-5-yl)acetyl]amino]-N-prop-2-enylbenzamide |
| SMILES | C=CCNC(=O)c1cccc(NC(=O)CC2SC(N3CCCCC3)=NC2=O)c1 |
| InChI | InChI=1S/C20H24N4O3S/c1-2-9-21-18(26)14-7-6-8-15(12-14)22-17(25)13-16-19(27)23-20(28-16)24-10-4-3-5-11-24/h2,6-8,12,16H,1,3-5,9-11,13H2,(H,21,26)(H,22,25) |
| InChIKey | SHTXLBBSOAJJQE-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|