C21H23N7O3S — CID 55565452
2-(4-oxo-2-piperidin-1-yl-1,3-thiazol-5-yl)-N-[3-[(pyrimidin-2-ylamino)carbamoyl]phenyl]acetamide (PubChem CID 55565452) has the molecular formula C21H23N7O3S and a molecular weight of 453.53 g/mol. Its IUPAC name is 2-(4-oxo-2-piperidin-1-yl-1,3-thiazol-5-yl)-N-[3-[(pyrimidin-2-ylamino)carbamoyl]phenyl]acetamide.
| Compound Name | 2-(4-oxo-2-piperidin-1-yl-1,3-thiazol-5-yl)-N-[3-[(pyrimidin-2-ylamino)carbamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 55565452 |
| Molecular Formula | C21H23N7O3S |
| Molecular Weight | 453.53 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | 2-(4-oxo-2-piperidin-1-yl-1,3-thiazol-5-yl)-N-[3-[(pyrimidin-2-ylamino)carbamoyl]phenyl]acetamide |
| SMILES | O=C(CC1SC(N2CCCCC2)=NC1=O)Nc1cccc(C(=O)NNc2ncccn2)c1 |
| InChI | InChI=1S/C21H23N7O3S/c29-17(13-16-19(31)25-21(32-16)28-10-2-1-3-11-28)24-15-7-4-6-14(12-15)18(30)26-27-20-22-8-5-9-23-20/h4-9,12,16H,1-3,10-11,13H2,(H,24,29)(H,26,30)(H,22,23,27) |
| InChIKey | LSZKSKHUFBMDHE-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 128.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.53 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|