C25H27N5O4S — CID 46541094
N-[3-[[(2-methylbenzoyl)amino]carbamoyl]phenyl]-2-(4-oxo-2-piperidin-1-yl-1,3-thiazol-5-yl)acetamide (PubChem CID 46541094) has the molecular formula C25H27N5O4S and a molecular weight of 493.59 g/mol. Its IUPAC name is N-[3-[[(2-methylbenzoyl)amino]carbamoyl]phenyl]-2-(4-oxo-2-piperidin-1-yl-1,3-thiazol-5-yl)acetamide.
| Compound Name | N-[3-[[(2-methylbenzoyl)amino]carbamoyl]phenyl]-2-(4-oxo-2-piperidin-1-yl-1,3-thiazol-5-yl)acetamide |
|---|---|
| PubChem CID | 46541094 |
| Molecular Formula | C25H27N5O4S |
| Molecular Weight | 493.59 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | N-[3-[[(2-methylbenzoyl)amino]carbamoyl]phenyl]-2-(4-oxo-2-piperidin-1-yl-1,3-thiazol-5-yl)acetamide |
| SMILES | Cc1ccccc1C(=O)NNC(=O)c1cccc(NC(=O)CC2SC(N3CCCCC3)=NC2=O)c1 |
| InChI | InChI=1S/C25H27N5O4S/c1-16-8-3-4-11-19(16)23(33)29-28-22(32)17-9-7-10-18(14-17)26-21(31)15-20-24(34)27-25(35-20)30-12-5-2-6-13-30/h3-4,7-11,14,20H,2,5-6,12-13,15H2,1H3,(H,26,31)(H,28,32)(H,29,33) |
| InChIKey | AUANHJXUARFEAM-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.59 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|