C19H27FN4O — CID 41016004
(2R)-N-[(2R)-2-cyano-3-methylbutan-2-yl]-2-[4-(4-fluorophenyl)piperazin-1-yl]propanamide (PubChem CID 41016004) has the molecular formula C19H27FN4O and a molecular weight of 346.45 g/mol. Its IUPAC name is (2R)-N-[(2R)-2-cyano-3-methylbutan-2-yl]-2-[4-(4-fluorophenyl)piperazin-1-yl]propanamide.
| Compound Name | (2R)-N-[(2R)-2-cyano-3-methylbutan-2-yl]-2-[4-(4-fluorophenyl)piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 41016004 |
| Molecular Formula | C19H27FN4O |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.22 |
| IUPAC Name | (2R)-N-[(2R)-2-cyano-3-methylbutan-2-yl]-2-[4-(4-fluorophenyl)piperazin-1-yl]propanamide |
| SMILES | CC(C)[C@](C)(C#N)NC(=O)[C@@H](C)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C19H27FN4O/c1-14(2)19(4,13-21)22-18(25)15(3)23-9-11-24(12-10-23)17-7-5-16(20)6-8-17/h5-8,14-15H,9-12H2,1-4H3,(H,22,25)/t15-,19+/m1/s1 |
| InChIKey | DPFWMRCVNMZJNM-BEFAXECRSA-N |
| XLogP | 2.39 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |