C20H27F3N4O — CID 18171113
N-(2-cyano-3-methylbutan-2-yl)-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propanamide (PubChem CID 18171113) has the molecular formula C20H27F3N4O and a molecular weight of 396.46 g/mol. Its IUPAC name is N-(2-cyano-3-methylbutan-2-yl)-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propanamide.
| Compound Name | N-(2-cyano-3-methylbutan-2-yl)-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 18171113 |
| Molecular Formula | C20H27F3N4O |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | N-(2-cyano-3-methylbutan-2-yl)-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propanamide |
| SMILES | CC(C(=O)NC(C)(C#N)C(C)C)N1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C20H27F3N4O/c1-14(2)19(4,13-24)25-18(28)15(3)26-8-10-27(11-9-26)17-7-5-6-16(12-17)20(21,22)23/h5-7,12,14-15H,8-11H2,1-4H3,(H,25,28) |
| InChIKey | YYXUTFQNQVBECK-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |