C21H22N4O6S — CID 41022606
[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]-[4-(2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carbonyl)piperazin-1-yl]methanone (PubChem CID 41022606) has the molecular formula C21H22N4O6S and a molecular weight of 458.50 g/mol. Its IUPAC name is [(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]-[4-(2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carbonyl)piperazin-1-yl]methanone.
| Compound Name | [(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]-[4-(2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carbonyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 41022606 |
| Molecular Formula | C21H22N4O6S |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | [(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]-[4-(2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carbonyl)piperazin-1-yl]methanone |
| SMILES | O=C(C1=CN2CCS(=O)(=O)N=C2C=C1)N1CCN(C(=O)[C@H]2COc3ccccc3O2)CC1 |
| InChI | InChI=1S/C21H22N4O6S/c26-20(15-5-6-19-22-32(28,29)12-11-25(19)13-15)23-7-9-24(10-8-23)21(27)18-14-30-16-3-1-2-4-17(16)31-18/h1-6,13,18H,7-12,14H2/t18-/m1/s1 |
| InChIKey | FVYGUUHVFDNETD-GOSISDBHSA-N |
| XLogP | -0.01 |
| TPSA | 108.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |