C20H20N4O3S2 — CID 26660476
[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-(2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazin-7-yl)methanone (PubChem CID 26660476) has the molecular formula C20H20N4O3S2 and a molecular weight of 428.54 g/mol. Its IUPAC name is [4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-(2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazin-7-yl)methanone.
| Compound Name | [4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-(2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazin-7-yl)methanone |
|---|---|
| PubChem CID | 26660476 |
| Molecular Formula | C20H20N4O3S2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | [4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-(2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazin-7-yl)methanone |
| SMILES | O=C(C1=CN2CCS(=O)(=O)N=C2C=C1)N1CCC(c2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C20H20N4O3S2/c25-20(15-5-6-18-22-29(26,27)12-11-24(18)13-15)23-9-7-14(8-10-23)19-21-16-3-1-2-4-17(16)28-19/h1-6,13-14H,7-12H2 |
| InChIKey | LVFNVRKWGJZMTF-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 82.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |