C20H18N2O2 — CID 41024276
(2S)-2-(furan-2-yl)-3-[(1S)-1-phenylethyl]-1,2-dihydroquinazolin-4-one (PubChem CID 41024276) has the molecular formula C20H18N2O2 and a molecular weight of 318.38 g/mol. Its IUPAC name is (2S)-2-(furan-2-yl)-3-[(1S)-1-phenylethyl]-1,2-dihydroquinazolin-4-one.
| Compound Name | (2S)-2-(furan-2-yl)-3-[(1S)-1-phenylethyl]-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 41024276 |
| Molecular Formula | C20H18N2O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | (2S)-2-(furan-2-yl)-3-[(1S)-1-phenylethyl]-1,2-dihydroquinazolin-4-one |
| SMILES | C[C@@H](c1ccccc1)N1C(=O)c2ccccc2N[C@@H]1c1ccco1 |
| InChI | InChI=1S/C20H18N2O2/c1-14(15-8-3-2-4-9-15)22-19(18-12-7-13-24-18)21-17-11-6-5-10-16(17)20(22)23/h2-14,19,21H,1H3/t14-,19-/m0/s1 |
| InChIKey | JTQMVSIPZVHNSC-LIRRHRJNSA-N |
| XLogP | 4.61 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |