C21H21N3O3S — CID 41025456
(3S)-1-(benzenesulfonyl)-N-quinolin-5-ylpiperidine-3-carboxamide (PubChem CID 41025456) has the molecular formula C21H21N3O3S and a molecular weight of 395.48 g/mol. Its IUPAC name is (3S)-1-(benzenesulfonyl)-N-quinolin-5-ylpiperidine-3-carboxamide.
| Compound Name | (3S)-1-(benzenesulfonyl)-N-quinolin-5-ylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 41025456 |
| Molecular Formula | C21H21N3O3S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | (3S)-1-(benzenesulfonyl)-N-quinolin-5-ylpiperidine-3-carboxamide |
| SMILES | O=C(Nc1cccc2ncccc12)[C@H]1CCCN(S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C21H21N3O3S/c25-21(23-20-12-4-11-19-18(20)10-5-13-22-19)16-7-6-14-24(15-16)28(26,27)17-8-2-1-3-9-17/h1-5,8-13,16H,6-7,14-15H2,(H,23,25)/t16-/m0/s1 |
| InChIKey | HBLXNQMPDSMODH-INIZCTEOSA-N |
| XLogP | 3.27 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |