C14H16BrFN2O3S2 — CID 41026628
(3aS,6aS)-3-(4-bromo-2-fluorophenyl)-1-(2-methoxyethyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole-2-thione (PubChem CID 41026628) has the molecular formula C14H16BrFN2O3S2 and a molecular weight of 423.33 g/mol. Its IUPAC name is (3aS,6aS)-3-(4-bromo-2-fluorophenyl)-1-(2-methoxyethyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole-2-thione.
| Compound Name | (3aS,6aS)-3-(4-bromo-2-fluorophenyl)-1-(2-methoxyethyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole-2-thione |
|---|---|
| PubChem CID | 41026628 |
| Molecular Formula | C14H16BrFN2O3S2 |
| Molecular Weight | 423.33 g/mol |
| Exact Mass | 421.98 |
| IUPAC Name | (3aS,6aS)-3-(4-bromo-2-fluorophenyl)-1-(2-methoxyethyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole-2-thione |
| SMILES | COCCN1C(=S)N(c2ccc(Br)cc2F)[C@@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C14H16BrFN2O3S2/c1-21-5-4-17-12-7-23(19,20)8-13(12)18(14(17)22)11-3-2-9(15)6-10(11)16/h2-3,6,12-13H,4-5,7-8H2,1H3/t12-,13-/m1/s1 |
| InChIKey | GUTPSZXGSOOUBX-CHWSQXEVSA-N |
| XLogP | 1.81 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.33 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|