C18H14N4O6S — CID 41028248
(Z)-N-[5-(3-methylsulfonylphenyl)-1,3,4-oxadiazol-2-yl]-3-(4-nitrophenyl)prop-2-enamide (PubChem CID 41028248) has the molecular formula C18H14N4O6S and a molecular weight of 414.40 g/mol. Its IUPAC name is (Z)-N-[5-(3-methylsulfonylphenyl)-1,3,4-oxadiazol-2-yl]-3-(4-nitrophenyl)prop-2-enamide.
| Compound Name | (Z)-N-[5-(3-methylsulfonylphenyl)-1,3,4-oxadiazol-2-yl]-3-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 41028248 |
| Molecular Formula | C18H14N4O6S |
| Molecular Weight | 414.40 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | (Z)-N-[5-(3-methylsulfonylphenyl)-1,3,4-oxadiazol-2-yl]-3-(4-nitrophenyl)prop-2-enamide |
| SMILES | CS(=O)(=O)c1cccc(-c2nnc(NC(=O)/C=C\c3ccc([N+](=O)[O-])cc3)o2)c1 |
| InChI | InChI=1S/C18H14N4O6S/c1-29(26,27)15-4-2-3-13(11-15)17-20-21-18(28-17)19-16(23)10-7-12-5-8-14(9-6-12)22(24)25/h2-11H,1H3,(H,19,21,23)/b10-7- |
| InChIKey | VWZRJVWWKLCBKZ-YFHOEESVSA-N |
| XLogP | 2.70 |
| TPSA | 145.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.40 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|