C16H11N5O4 — CID 5244031
3-(4-nitrophenyl)-N-(5-pyridin-2-yl-1,3,4-oxadiazol-2-yl)prop-2-enamide (PubChem CID 5244031) has the molecular formula C16H11N5O4 and a molecular weight of 337.30 g/mol. Its IUPAC name is 3-(4-nitrophenyl)-N-(5-pyridin-2-yl-1,3,4-oxadiazol-2-yl)prop-2-enamide.
| Compound Name | 3-(4-nitrophenyl)-N-(5-pyridin-2-yl-1,3,4-oxadiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 5244031 |
| Molecular Formula | C16H11N5O4 |
| Molecular Weight | 337.30 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 3-(4-nitrophenyl)-N-(5-pyridin-2-yl-1,3,4-oxadiazol-2-yl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccc([N+](=O)[O-])cc1)Nc1nnc(-c2ccccn2)o1 |
| InChI | InChI=1S/C16H11N5O4/c22-14(9-6-11-4-7-12(8-5-11)21(23)24)18-16-20-19-15(25-16)13-3-1-2-10-17-13/h1-10H,(H,18,20,22) |
| InChIKey | WLNBMMSPZLQEHE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 124.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.30 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|