C18H22N2O7S2 — CID 41029083
5-[[(3aS,6aS)-3-(3,4-dimethoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-5-oxopentanoic acid (PubChem CID 41029083) has the molecular formula C18H22N2O7S2 and a molecular weight of 442.52 g/mol. Its IUPAC name is 5-[[(3aS,6aS)-3-(3,4-dimethoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-5-oxopentanoic acid.
| Compound Name | 5-[[(3aS,6aS)-3-(3,4-dimethoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 41029083 |
| Molecular Formula | C18H22N2O7S2 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | 5-[[(3aS,6aS)-3-(3,4-dimethoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-5-oxopentanoic acid |
| SMILES | COc1ccc(N2/C(=N/C(=O)CCCC(=O)O)S[C@@H]3CS(=O)(=O)C[C@@H]32)cc1OC |
| InChI | InChI=1S/C18H22N2O7S2/c1-26-13-7-6-11(8-14(13)27-2)20-12-9-29(24,25)10-15(12)28-18(20)19-16(21)4-3-5-17(22)23/h6-8,12,15H,3-5,9-10H2,1-2H3,(H,22,23)/b19-18-/t12-,15+/m0/s1 |
| InChIKey | QKSFSFXEPGTZJU-ZSGLKTKSSA-N |
| XLogP | 1.56 |
| TPSA | 122.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|