C19H15N3O8 — CID 41040329
(5R)-1-(2-hydroxyethyl)-4-[hydroxy-(4-nitrophenyl)methylidene]-5-(2-nitrophenyl)pyrrolidine-2,3-dione (PubChem CID 41040329) has the molecular formula C19H15N3O8 and a molecular weight of 413.34 g/mol. Its IUPAC name is (5R)-1-(2-hydroxyethyl)-4-[hydroxy-(4-nitrophenyl)methylidene]-5-(2-nitrophenyl)pyrrolidine-2,3-dione.
| Compound Name | (5R)-1-(2-hydroxyethyl)-4-[hydroxy-(4-nitrophenyl)methylidene]-5-(2-nitrophenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 41040329 |
| Molecular Formula | C19H15N3O8 |
| Molecular Weight | 413.34 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | (5R)-1-(2-hydroxyethyl)-4-[hydroxy-(4-nitrophenyl)methylidene]-5-(2-nitrophenyl)pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(CCO)[C@H](c2ccccc2[N+](=O)[O-])C1=C(O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H15N3O8/c23-10-9-20-16(13-3-1-2-4-14(13)22(29)30)15(18(25)19(20)26)17(24)11-5-7-12(8-6-11)21(27)28/h1-8,16,23-24H,9-10H2/t16-/m1/s1 |
| InChIKey | YDNMMRXVQNNNHG-MRXNPFEDSA-N |
| XLogP | 1.92 |
| TPSA | 164.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.34 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|