C19H14N2O7 — CID 6981368
2-[(2R,3Z)-3-[hydroxy(phenyl)methylidene]-2-(2-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]acetic acid (PubChem CID 6981368) has the molecular formula C19H14N2O7 and a molecular weight of 382.33 g/mol. Its IUPAC name is 2-[(2R,3Z)-3-[hydroxy(phenyl)methylidene]-2-(2-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]acetic acid.
| Compound Name | 2-[(2R,3Z)-3-[hydroxy(phenyl)methylidene]-2-(2-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 6981368 |
| Molecular Formula | C19H14N2O7 |
| Molecular Weight | 382.33 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 2-[(2R,3Z)-3-[hydroxy(phenyl)methylidene]-2-(2-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)C(=O)/C(=C(\O)c2ccccc2)[C@H]1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H14N2O7/c22-14(23)10-20-16(12-8-4-5-9-13(12)21(27)28)15(18(25)19(20)26)17(24)11-6-2-1-3-7-11/h1-9,16,24H,10H2,(H,22,23)/b17-15-/t16-/m1/s1 |
| InChIKey | DIIACTOCFUCGQO-CFBLSMTOSA-N |
| XLogP | 2.10 |
| TPSA | 138.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.33 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|