C19H13FN2O7 — CID 3769575
2-[2-(2-fluorophenyl)-3-[hydroxy-(4-nitrophenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]acetic acid (PubChem CID 3769575) has the molecular formula C19H13FN2O7 and a molecular weight of 400.32 g/mol. Its IUPAC name is 2-[2-(2-fluorophenyl)-3-[hydroxy-(4-nitrophenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]acetic acid.
| Compound Name | 2-[2-(2-fluorophenyl)-3-[hydroxy-(4-nitrophenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 3769575 |
| Molecular Formula | C19H13FN2O7 |
| Molecular Weight | 400.32 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | 2-[2-(2-fluorophenyl)-3-[hydroxy-(4-nitrophenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)C(=O)C(=C(O)c2ccc([N+](=O)[O-])cc2)C1c1ccccc1F |
| InChI | InChI=1S/C19H13FN2O7/c20-13-4-2-1-3-12(13)16-15(18(26)19(27)21(16)9-14(23)24)17(25)10-5-7-11(8-6-10)22(28)29/h1-8,16,25H,9H2,(H,23,24) |
| InChIKey | BRAIYFOCVMHTSA-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 138.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|