C19H13N3O9 — CID 98380976
2-[(2S,3E)-3-[hydroxy-(4-nitrophenyl)methylidene]-2-(4-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]acetic acid (PubChem CID 98380976) has the molecular formula C19H13N3O9 and a molecular weight of 427.33 g/mol. Its IUPAC name is 2-[(2S,3E)-3-[hydroxy-(4-nitrophenyl)methylidene]-2-(4-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]acetic acid.
| Compound Name | 2-[(2S,3E)-3-[hydroxy-(4-nitrophenyl)methylidene]-2-(4-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 98380976 |
| Molecular Formula | C19H13N3O9 |
| Molecular Weight | 427.33 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | 2-[(2S,3E)-3-[hydroxy-(4-nitrophenyl)methylidene]-2-(4-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)C(=O)/C(=C(/O)c2ccc([N+](=O)[O-])cc2)[C@@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H13N3O9/c23-14(24)9-20-16(10-1-5-12(6-2-10)21(28)29)15(18(26)19(20)27)17(25)11-3-7-13(8-4-11)22(30)31/h1-8,16,25H,9H2,(H,23,24)/b17-15+/t16-/m0/s1 |
| InChIKey | QHXDWCUTRDCIPI-UYTDBDHRSA-N |
| XLogP | 2.01 |
| TPSA | 181.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.33 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|