C21H17N3O9 — CID 98317654
4-[(2R,3E)-3-[hydroxy-(4-nitrophenyl)methylidene]-2-(4-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]butanoic acid (PubChem CID 98317654) has the molecular formula C21H17N3O9 and a molecular weight of 455.38 g/mol. Its IUPAC name is 4-[(2R,3E)-3-[hydroxy-(4-nitrophenyl)methylidene]-2-(4-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]butanoic acid.
| Compound Name | 4-[(2R,3E)-3-[hydroxy-(4-nitrophenyl)methylidene]-2-(4-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 98317654 |
| Molecular Formula | C21H17N3O9 |
| Molecular Weight | 455.38 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | 4-[(2R,3E)-3-[hydroxy-(4-nitrophenyl)methylidene]-2-(4-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]butanoic acid |
| SMILES | O=C(O)CCCN1C(=O)C(=O)/C(=C(/O)c2ccc([N+](=O)[O-])cc2)[C@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H17N3O9/c25-16(26)2-1-11-22-18(12-3-7-14(8-4-12)23(30)31)17(20(28)21(22)29)19(27)13-5-9-15(10-6-13)24(32)33/h3-10,18,27H,1-2,11H2,(H,25,26)/b19-17+/t18-/m1/s1 |
| InChIKey | PZMPHZJWEWJTPD-SELCWUDQSA-N |
| XLogP | 2.79 |
| TPSA | 181.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|