C22H20N4O3 — CID 41042312
(12S)-3,3-dimethyl-12-(3-nitrophenyl)-2,4,5,12-tetrahydrobenzimidazolo[2,1-b]quinazolin-1-one (PubChem CID 41042312) has the molecular formula C22H20N4O3 and a molecular weight of 388.43 g/mol. Its IUPAC name is (12S)-3,3-dimethyl-12-(3-nitrophenyl)-2,4,5,12-tetrahydrobenzimidazolo[2,1-b]quinazolin-1-one.
| Compound Name | (12S)-3,3-dimethyl-12-(3-nitrophenyl)-2,4,5,12-tetrahydrobenzimidazolo[2,1-b]quinazolin-1-one |
|---|---|
| PubChem CID | 41042312 |
| Molecular Formula | C22H20N4O3 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | (12S)-3,3-dimethyl-12-(3-nitrophenyl)-2,4,5,12-tetrahydrobenzimidazolo[2,1-b]quinazolin-1-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1nc3ccccc3n1[C@H]2c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H20N4O3/c1-22(2)11-16-19(18(27)12-22)20(13-6-5-7-14(10-13)26(28)29)25-17-9-4-3-8-15(17)23-21(25)24-16/h3-10,20H,11-12H2,1-2H3,(H,23,24)/t20-/m0/s1 |
| InChIKey | IWIWKVINOMJLJY-FQEVSTJZSA-N |
| XLogP | 4.60 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|