C24H25N3O3 — CID 2960266
12-(3-ethoxy-4-hydroxyphenyl)-3,3-dimethyl-2,4,5,12-tetrahydrobenzimidazolo[2,1-b]quinazolin-1-one (PubChem CID 2960266) has the molecular formula C24H25N3O3 and a molecular weight of 403.48 g/mol. Its IUPAC name is 12-(3-ethoxy-4-hydroxyphenyl)-3,3-dimethyl-2,4,5,12-tetrahydrobenzimidazolo[2,1-b]quinazolin-1-one.
| Compound Name | 12-(3-ethoxy-4-hydroxyphenyl)-3,3-dimethyl-2,4,5,12-tetrahydrobenzimidazolo[2,1-b]quinazolin-1-one |
|---|---|
| PubChem CID | 2960266 |
| Molecular Formula | C24H25N3O3 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 12-(3-ethoxy-4-hydroxyphenyl)-3,3-dimethyl-2,4,5,12-tetrahydrobenzimidazolo[2,1-b]quinazolin-1-one |
| SMILES | CCOc1cc(C2C3=C(CC(C)(C)CC3=O)Nc3nc4ccccc4n32)ccc1O |
| InChI | InChI=1S/C24H25N3O3/c1-4-30-20-11-14(9-10-18(20)28)22-21-16(12-24(2,3)13-19(21)29)26-23-25-15-7-5-6-8-17(15)27(22)23/h5-11,22,28H,4,12-13H2,1-3H3,(H,25,26) |
| InChIKey | BUCJYGIXKBNZQW-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |