C19H18N2O5S2 — CID 41044655
1,3-benzodioxol-5-yl (2R)-2-[(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]propanoate (PubChem CID 41044655) has the molecular formula C19H18N2O5S2 and a molecular weight of 418.50 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl (2R)-2-[(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]propanoate.
| Compound Name | 1,3-benzodioxol-5-yl (2R)-2-[(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]propanoate |
|---|---|
| PubChem CID | 41044655 |
| Molecular Formula | C19H18N2O5S2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | 1,3-benzodioxol-5-yl (2R)-2-[(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]propanoate |
| SMILES | Cc1sc2nc(CS[C@H](C)C(=O)Oc3ccc4c(c3)OCO4)[nH]c(=O)c2c1C |
| InChI | InChI=1S/C19H18N2O5S2/c1-9-10(2)28-18-16(9)17(22)20-15(21-18)7-27-11(3)19(23)26-12-4-5-13-14(6-12)25-8-24-13/h4-6,11H,7-8H2,1-3H3,(H,20,21,22)/t11-/m1/s1 |
| InChIKey | NNYIXODOMUSXDA-LLVKDONJSA-N |
| XLogP | 3.56 |
| TPSA | 90.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|