C25H19N3O4S — CID 4104478
2-benzyl-5-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]sulfanyl-2H-imidazo[1,2-c]quinazolin-3-one (PubChem CID 4104478) has the molecular formula C25H19N3O4S and a molecular weight of 457.51 g/mol. Its IUPAC name is 2-benzyl-5-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]sulfanyl-2H-imidazo[1,2-c]quinazolin-3-one.
| Compound Name | 2-benzyl-5-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]sulfanyl-2H-imidazo[1,2-c]quinazolin-3-one |
|---|---|
| PubChem CID | 4104478 |
| Molecular Formula | C25H19N3O4S |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | 2-benzyl-5-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]sulfanyl-2H-imidazo[1,2-c]quinazolin-3-one |
| SMILES | O=C(CSC1=Nc2ccccc2C2=NC(Cc3ccccc3)C(=O)N12)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C25H19N3O4S/c29-20-11-10-16(13-21(20)30)22(31)14-33-25-27-18-9-5-4-8-17(18)23-26-19(24(32)28(23)25)12-15-6-2-1-3-7-15/h1-11,13,19,29-30H,12,14H2 |
| InChIKey | MSXFUGLGRYWJCO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 102.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|