C22H21N3O2S — CID 4305426
2-butan-2-yl-5-phenacylsulfanyl-2H-imidazo[1,2-c]quinazolin-3-one (PubChem CID 4305426) has the molecular formula C22H21N3O2S and a molecular weight of 391.50 g/mol. Its IUPAC name is 2-butan-2-yl-5-phenacylsulfanyl-2H-imidazo[1,2-c]quinazolin-3-one.
| Compound Name | 2-butan-2-yl-5-phenacylsulfanyl-2H-imidazo[1,2-c]quinazolin-3-one |
|---|---|
| PubChem CID | 4305426 |
| Molecular Formula | C22H21N3O2S |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 2-butan-2-yl-5-phenacylsulfanyl-2H-imidazo[1,2-c]quinazolin-3-one |
| SMILES | CCC(C)C1N=C2c3ccccc3N=C(SCC(=O)c3ccccc3)N2C1=O |
| InChI | InChI=1S/C22H21N3O2S/c1-3-14(2)19-21(27)25-20(24-19)16-11-7-8-12-17(16)23-22(25)28-13-18(26)15-9-5-4-6-10-15/h4-12,14,19H,3,13H2,1-2H3 |
| InChIKey | SUXOOFTXWNUEPC-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 62.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |